C15H5Br2Cl2F7OS — CID 173059816
1,5-dibromo-2-(3,4-dichlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene (PubChem CID 173059816) has the molecular formula C15H5Br2Cl2F7OS and a molecular weight of 596.97 g/mol. Its IUPAC name is 1,5-dibromo-2-(3,4-dichlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene.
| Compound Name | 1,5-dibromo-2-(3,4-dichlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene |
|---|---|
| PubChem CID | 173059816 |
| Molecular Formula | C15H5Br2Cl2F7OS |
| Molecular Weight | 596.97 g/mol |
| Exact Mass | 593.77 |
| IUPAC Name | 1,5-dibromo-2-(3,4-dichlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene |
| SMILES | O=S(c1cc(Br)cc(Br)c1-c1ccc(Cl)c(Cl)c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H5Br2Cl2F7OS/c16-7-4-8(17)12(6-1-2-9(18)10(19)3-6)11(5-7)28(27)15(25,26)13(20,21)14(22,23)24/h1-5H |
| InChIKey | LFTWYSAYPBRPMY-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.97 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|