C15H6Br2F8 — CID 173054838
1,5-dibromo-2-(4-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (PubChem CID 173054838) has the molecular formula C15H6Br2F8 and a molecular weight of 498.01 g/mol. Its IUPAC name is 1,5-dibromo-2-(4-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene.
| Compound Name | 1,5-dibromo-2-(4-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 173054838 |
| Molecular Formula | C15H6Br2F8 |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 495.87 |
| IUPAC Name | 1,5-dibromo-2-(4-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| SMILES | Fc1ccc(-c2c(Br)cc(Br)cc2C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H6Br2F8/c16-8-5-10(13(19,14(20,21)22)15(23,24)25)12(11(17)6-8)7-1-3-9(18)4-2-7/h1-6H |
| InChIKey | VGLWPZJBEQHXHB-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |