C16H6BrF11 — CID 173054694
1-bromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene (PubChem CID 173054694) has the molecular formula C16H6BrF11 and a molecular weight of 487.11 g/mol. Its IUPAC name is 1-bromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 173054694 |
| Molecular Formula | C16H6BrF11 |
| Molecular Weight | 487.11 g/mol |
| Exact Mass | 485.95 |
| IUPAC Name | 1-bromo-2-(2-fluorophenyl)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)benzene |
| SMILES | Fc1ccccc1-c1c(Br)cc(C(F)(F)F)cc1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H6BrF11/c17-10-6-7(14(20,21)22)5-9(12(10)8-3-1-2-4-11(8)18)13(19,15(23,24)25)16(26,27)28/h1-6H |
| InChIKey | FWJLHXFCQHICND-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.11 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |