C17H6F13I — CID 173054638
2-(2-fluorophenyl)-1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethyl)benzene (PubChem CID 173054638) has the molecular formula C17H6F13I and a molecular weight of 584.11 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethyl)benzene.
| Compound Name | 2-(2-fluorophenyl)-1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 173054638 |
| Molecular Formula | C17H6F13I |
| Molecular Weight | 584.11 g/mol |
| Exact Mass | 583.93 |
| IUPAC Name | 2-(2-fluorophenyl)-1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethyl)benzene |
| SMILES | Fc1ccccc1-c1c(I)cc(C(F)(F)F)cc1C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H6F13I/c18-10-4-2-1-3-8(10)12-9(5-7(6-11(12)31)14(20,21)22)13(19,16(25,26)27)15(23,24)17(28,29)30/h1-6H |
| InChIKey | GPJWYDCLGCOMGN-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.11 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|