C13H4Cl3F12I — CID 173054709
1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-(2,2,2-trichloroethyl)-5-(trifluoromethyl)benzene (PubChem CID 173054709) has the molecular formula C13H4Cl3F12I and a molecular weight of 621.41 g/mol. Its IUPAC name is 1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-(2,2,2-trichloroethyl)-5-(trifluoromethyl)benzene.
| Compound Name | 1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-(2,2,2-trichloroethyl)-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 173054709 |
| Molecular Formula | C13H4Cl3F12I |
| Molecular Weight | 621.41 g/mol |
| Exact Mass | 619.82 |
| IUPAC Name | 1-iodo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-(2,2,2-trichloroethyl)-5-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(I)c(CC(Cl)(Cl)Cl)c(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H4Cl3F12I/c14-8(15,16)3-5-6(1-4(2-7(5)29)10(18,19)20)9(17,12(23,24)25)11(21,22)13(26,27)28/h1-2H,3H2 |
| InChIKey | FCKIOXGHSLSIEE-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.41 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|