About 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride
2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride (PubChem CID 134638251) has the molecular formula C8H2ClF6IO2S
and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride |
| PubChem CID | 134638251 |
| Molecular Formula | C8H2ClF6IO2S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c(I)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C8H2ClF6IO2S/c9-19(17,18)6-4(8(13,14)15)1-3(2-5(6)16)7(10,11)12/h1-2H |
| InChIKey | FYPQHSHDOZYBJR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride?
The IUPAC name of 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride (CID 134638251) is 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride.
What is the SMILES notation for 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride?
The canonical SMILES for 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride is O=S(=O)(Cl)c1c(I)cc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride?
The InChIKey is FYPQHSHDOZYBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2ClF6IO2S/c9-19(17,18)6-4(8(13,14)15)1-3(2-5(6)16)7(10,11)12/h1-2H.
What are the key properties of 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride?
2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride has a molecular weight of 438.51 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride is sourced from PubChem (CID 134638251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).