C8H2ClF6IO2S — CID 134638251
2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride (PubChem CID 134638251) has the molecular formula C8H2ClF6IO2S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride.
| Compound Name | 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 134638251 |
| Molecular Formula | C8H2ClF6IO2S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c(I)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C8H2ClF6IO2S/c9-19(17,18)6-4(8(13,14)15)1-3(2-5(6)16)7(10,11)12/h1-2H |
| InChIKey | FYPQHSHDOZYBJR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|