C9H5ClF6O2S — CID 87086409
[2,4-bis(trifluoromethyl)phenyl]methanesulfonyl chloride (PubChem CID 87086409) has the molecular formula C9H5ClF6O2S and a molecular weight of 326.65 g/mol. Its IUPAC name is [2,4-bis(trifluoromethyl)phenyl]methanesulfonyl chloride.
| Compound Name | [2,4-bis(trifluoromethyl)phenyl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 87086409 |
| Molecular Formula | C9H5ClF6O2S |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | [2,4-bis(trifluoromethyl)phenyl]methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H5ClF6O2S/c10-19(17,18)4-5-1-2-6(8(11,12)13)3-7(5)9(14,15)16/h1-3H,4H2 |
| InChIKey | IABGHIAKQXDULI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |