C8H4F6INO2S — CID 119003736
2-iodo-4,6-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 119003736) has the molecular formula C8H4F6INO2S and a molecular weight of 419.08 g/mol. Its IUPAC name is 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119003736 |
| Molecular Formula | C8H4F6INO2S |
| Molecular Weight | 419.08 g/mol |
| Exact Mass | 418.89 |
| IUPAC Name | 2-iodo-4,6-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(I)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C8H4F6INO2S/c9-7(10,11)3-1-4(8(12,13)14)6(5(15)2-3)19(16,17)18/h1-2H,(H2,16,17,18) |
| InChIKey | NPBKJFGPKIMMGU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.08 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|