C15H6Br2F8OS — CID 173059611
1,5-dibromo-2-(3-fluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene (PubChem CID 173059611) has the molecular formula C15H6Br2F8OS and a molecular weight of 546.07 g/mol. Its IUPAC name is 1,5-dibromo-2-(3-fluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene.
| Compound Name | 1,5-dibromo-2-(3-fluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene |
|---|---|
| PubChem CID | 173059611 |
| Molecular Formula | C15H6Br2F8OS |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 543.84 |
| IUPAC Name | 1,5-dibromo-2-(3-fluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene |
| SMILES | O=S(c1cc(Br)cc(Br)c1-c1cccc(F)c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H6Br2F8OS/c16-8-5-10(17)12(7-2-1-3-9(18)4-7)11(6-8)27(26)15(24,25)13(19,20)14(21,22)23/h1-6H |
| InChIKey | HXZHOTUQITVUKA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|