About 1-bromo-3-fluorobenzene;sulfane
1-bromo-3-fluorobenzene;sulfane (PubChem CID 174932611) has the molecular formula C6H6BrFS
and a molecular weight of 209.08 g/mol. Its IUPAC name is 1-bromo-3-fluorobenzene;sulfane.
Molecular Properties
| Compound Name | 1-bromo-3-fluorobenzene;sulfane |
| PubChem CID | 174932611 |
| Molecular Formula | C6H6BrFS |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 207.94 |
| IUPAC Name | 1-bromo-3-fluorobenzene;sulfane |
| SMILES | Fc1cccc(Br)c1.S |
| InChI | InChI=1S/C6H4BrF.H2S/c7-5-2-1-3-6(8)4-5;/h1-4H;1H2 |
| InChIKey | QIPCIYZXKQOBIH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-fluorobenzene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-fluorobenzene;sulfane?
The IUPAC name of 1-bromo-3-fluorobenzene;sulfane (CID 174932611) is 1-bromo-3-fluorobenzene;sulfane.
What is the SMILES notation for 1-bromo-3-fluorobenzene;sulfane?
The canonical SMILES for 1-bromo-3-fluorobenzene;sulfane is Fc1cccc(Br)c1.S.
What is the InChIKey of 1-bromo-3-fluorobenzene;sulfane?
The InChIKey is QIPCIYZXKQOBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF.H2S/c7-5-2-1-3-6(8)4-5;/h1-4H;1H2.
What are the key properties of 1-bromo-3-fluorobenzene;sulfane?
1-bromo-3-fluorobenzene;sulfane has a molecular weight of 209.08 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-fluorobenzene;sulfane is sourced from PubChem (CID 174932611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).