C18H13BrFNO2 — CID 10948752
5-(N-(3-bromophenyl)-3-fluoroanilino)benzene-1,3-diol (PubChem CID 10948752) has the molecular formula C18H13BrFNO2 and a molecular weight of 374.21 g/mol. Its IUPAC name is 5-(N-(3-bromophenyl)-3-fluoroanilino)benzene-1,3-diol.
| Compound Name | 5-(N-(3-bromophenyl)-3-fluoroanilino)benzene-1,3-diol |
|---|---|
| PubChem CID | 10948752 |
| Molecular Formula | C18H13BrFNO2 |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 5-(N-(3-bromophenyl)-3-fluoroanilino)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(N(c2cccc(F)c2)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C18H13BrFNO2/c19-12-3-1-5-14(7-12)21(15-6-2-4-13(20)8-15)16-9-17(22)11-18(23)10-16/h1-11,22-23H |
| InChIKey | HLFFWXYOSULTAX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |