C18H6F12IN — CID 173054636
4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodo-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzonitrile (PubChem CID 173054636) has the molecular formula C18H6F12IN and a molecular weight of 591.13 g/mol. Its IUPAC name is 4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodo-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzonitrile.
| Compound Name | 4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodo-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 173054636 |
| Molecular Formula | C18H6F12IN |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 590.94 |
| IUPAC Name | 4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-iodo-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(I)cc(C(F)(F)C(F)(F)F)cc2C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H6F12IN/c19-14(16(22,23)24,17(25,26)27)11-5-10(15(20,21)18(28,29)30)6-12(31)13(11)9-3-1-8(7-32)2-4-9/h1-6H |
| InChIKey | BRZGXXGAVURDBK-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|