C27H14I4N2 — CID 134365864
4-[4-[[4-(4-cyano-2,6-diiodophenyl)phenyl]methyl]phenyl]-3,5-diiodobenzonitrile (PubChem CID 134365864) has the molecular formula C27H14I4N2 and a molecular weight of 874.04 g/mol. Its IUPAC name is 4-[4-[[4-(4-cyano-2,6-diiodophenyl)phenyl]methyl]phenyl]-3,5-diiodobenzonitrile.
| Compound Name | 4-[4-[[4-(4-cyano-2,6-diiodophenyl)phenyl]methyl]phenyl]-3,5-diiodobenzonitrile |
|---|---|
| PubChem CID | 134365864 |
| Molecular Formula | C27H14I4N2 |
| Molecular Weight | 874.04 g/mol |
| Exact Mass | 873.73 |
| IUPAC Name | 4-[4-[[4-(4-cyano-2,6-diiodophenyl)phenyl]methyl]phenyl]-3,5-diiodobenzonitrile |
| SMILES | N#Cc1cc(I)c(-c2ccc(Cc3ccc(-c4c(I)cc(C#N)cc4I)cc3)cc2)c(I)c1 |
| InChI | InChI=1S/C27H14I4N2/c28-22-10-18(14-32)11-23(29)26(22)20-5-1-16(2-6-20)9-17-3-7-21(8-4-17)27-24(30)12-19(15-33)13-25(27)31/h1-8,10-13H,9H2 |
| InChIKey | CAYHIHLNDWHMOO-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.04 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|