C15H5Br2F9O2S — CID 173059430
1,5-dibromo-2-(2,4-difluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene (PubChem CID 173059430) has the molecular formula C15H5Br2F9O2S and a molecular weight of 580.06 g/mol. Its IUPAC name is 1,5-dibromo-2-(2,4-difluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene.
| Compound Name | 1,5-dibromo-2-(2,4-difluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene |
|---|---|
| PubChem CID | 173059430 |
| Molecular Formula | C15H5Br2F9O2S |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 577.82 |
| IUPAC Name | 1,5-dibromo-2-(2,4-difluorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)benzene |
| SMILES | O=S(=O)(c1cc(Br)cc(Br)c1-c1ccc(F)cc1F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H5Br2F9O2S/c16-6-3-9(17)12(8-2-1-7(18)5-10(8)19)11(4-6)29(27,28)15(25,26)13(20,21)14(22,23)24/h1-5H |
| InChIKey | FSHDMRKRAMVTEY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|