C10H11BrF2O2S — CID 123874974
1-bromo-4-tert-butylsulfonyl-2,5-difluorobenzene (PubChem CID 123874974) has the molecular formula C10H11BrF2O2S and a molecular weight of 313.16 g/mol. Its IUPAC name is 1-bromo-4-tert-butylsulfonyl-2,5-difluorobenzene.
| Compound Name | 1-bromo-4-tert-butylsulfonyl-2,5-difluorobenzene |
|---|---|
| PubChem CID | 123874974 |
| Molecular Formula | C10H11BrF2O2S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 1-bromo-4-tert-butylsulfonyl-2,5-difluorobenzene |
| SMILES | CC(C)(C)S(=O)(=O)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C10H11BrF2O2S/c1-10(2,3)16(14,15)9-5-7(12)6(11)4-8(9)13/h4-5H,1-3H3 |
| InChIKey | JBEBHLBEFYZHFF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|