C16H8Br3F7N2OS — CID 87233707
2-amino-N-[2,4,6-tribromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide (PubChem CID 87233707) has the molecular formula C16H8Br3F7N2OS and a molecular weight of 649.02 g/mol. Its IUPAC name is 2-amino-N-[2,4,6-tribromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide.
| Compound Name | 2-amino-N-[2,4,6-tribromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 87233707 |
| Molecular Formula | C16H8Br3F7N2OS |
| Molecular Weight | 649.02 g/mol |
| Exact Mass | 645.78 |
| IUPAC Name | 2-amino-N-[2,4,6-tribromo-3-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]benzamide |
| SMILES | Nc1ccccc1C(=O)Nc1c(Br)cc(Br)c(SC(F)(F)C(F)(F)C(F)(F)F)c1Br |
| InChI | InChI=1S/C16H8Br3F7N2OS/c17-7-5-8(18)12(30-16(25,26)14(20,21)15(22,23)24)10(19)11(7)28-13(29)6-3-1-2-4-9(6)27/h1-5H,27H2,(H,28,29) |
| InChIKey | CHWQAUGBIHMENJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.02 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|