C9H7F3N2O2 — CID 86115916
2-amino-N-(2,2,2-trifluoroacetyl)benzamide (PubChem CID 86115916) has the molecular formula C9H7F3N2O2 and a molecular weight of 232.16 g/mol. Its IUPAC name is 2-amino-N-(2,2,2-trifluoroacetyl)benzamide.
| Compound Name | 2-amino-N-(2,2,2-trifluoroacetyl)benzamide |
|---|---|
| PubChem CID | 86115916 |
| Molecular Formula | C9H7F3N2O2 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-amino-N-(2,2,2-trifluoroacetyl)benzamide |
| SMILES | Nc1ccccc1C(=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7F3N2O2/c10-9(11,12)8(16)14-7(15)5-3-1-2-4-6(5)13/h1-4H,13H2,(H,14,15,16) |
| InChIKey | ROEJVHFYWPOWIO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|