C11H12N2O — CID 102220906
2-amino-N-buta-2,3-dienylbenzamide (PubChem CID 102220906) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-amino-N-buta-2,3-dienylbenzamide.
| Compound Name | 2-amino-N-buta-2,3-dienylbenzamide |
|---|---|
| PubChem CID | 102220906 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-amino-N-buta-2,3-dienylbenzamide |
| SMILES | C=C=CCNC(=O)c1ccccc1N |
| InChI | InChI=1S/C11H12N2O/c1-2-3-8-13-11(14)9-6-4-5-7-10(9)12/h3-7H,1,8,12H2,(H,13,14) |
| InChIKey | MRGLWADUWVQWGM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|