C10H13F2N3O — CID 122081037
2-amino-N-(3-amino-2,2-difluoropropyl)benzamide (PubChem CID 122081037) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-amino-N-(3-amino-2,2-difluoropropyl)benzamide.
| Compound Name | 2-amino-N-(3-amino-2,2-difluoropropyl)benzamide |
|---|---|
| PubChem CID | 122081037 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-amino-N-(3-amino-2,2-difluoropropyl)benzamide |
| SMILES | NCC(F)(F)CNC(=O)c1ccccc1N |
| InChI | InChI=1S/C10H13F2N3O/c11-10(12,5-13)6-15-9(16)7-3-1-2-4-8(7)14/h1-4H,5-6,13-14H2,(H,15,16) |
| InChIKey | PERKDLGNISZSRC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|