C14H15F2N3O — CID 114383383
N-(3-amino-2,2-difluoropropyl)-2-methylquinoline-4-carboxamide (PubChem CID 114383383) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-2-methylquinoline-4-carboxamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 114383383 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(F)(F)CN)c2ccccc2n1 |
| InChI | InChI=1S/C14H15F2N3O/c1-9-6-11(10-4-2-3-5-12(10)19-9)13(20)18-8-14(15,16)7-17/h2-6H,7-8,17H2,1H3,(H,18,20) |
| InChIKey | CRRCZNWNIVRPMU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |