C15H15IN2O3 — CID 103493219
methyl 2-iodo-3-[(2-methylquinoline-4-carbonyl)amino]propanoate (PubChem CID 103493219) has the molecular formula C15H15IN2O3 and a molecular weight of 398.20 g/mol. Its IUPAC name is methyl 2-iodo-3-[(2-methylquinoline-4-carbonyl)amino]propanoate.
| Compound Name | methyl 2-iodo-3-[(2-methylquinoline-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103493219 |
| Molecular Formula | C15H15IN2O3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | methyl 2-iodo-3-[(2-methylquinoline-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(I)CNC(=O)c1cc(C)nc2ccccc12 |
| InChI | InChI=1S/C15H15IN2O3/c1-9-7-11(10-5-3-4-6-13(10)18-9)14(19)17-8-12(16)15(20)21-2/h3-7,12H,8H2,1-2H3,(H,17,19) |
| InChIKey | KZFRYIBDRQCZEB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|