C13H11N3O — CID 51890088
N-(cyanomethyl)-2-methylquinoline-4-carboxamide (PubChem CID 51890088) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is N-(cyanomethyl)-2-methylquinoline-4-carboxamide.
| Compound Name | N-(cyanomethyl)-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 51890088 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-(cyanomethyl)-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC#N)c2ccccc2n1 |
| InChI | InChI=1S/C13H11N3O/c1-9-8-11(13(17)15-7-6-14)10-4-2-3-5-12(10)16-9/h2-5,8H,7H2,1H3,(H,15,17) |
| InChIKey | MEGOWVSPNWCNQA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|