C14H13N3O — CID 61119261
N-(1-cyanoethyl)-2-methylquinoline-4-carboxamide (PubChem CID 61119261) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is N-(1-cyanoethyl)-2-methylquinoline-4-carboxamide.
| Compound Name | N-(1-cyanoethyl)-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 61119261 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-(1-cyanoethyl)-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)C#N)c2ccccc2n1 |
| InChI | InChI=1S/C14H13N3O/c1-9-7-12(14(18)17-10(2)8-15)11-5-3-4-6-13(11)16-9/h3-7,10H,1-2H3,(H,17,18) |
| InChIKey | RLKZHXXXXIZPNO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |