C9H4BrF6NO — CID 134640617
2-bromo-3,5-bis(trifluoromethyl)benzamide (PubChem CID 134640617) has the molecular formula C9H4BrF6NO and a molecular weight of 336.03 g/mol. Its IUPAC name is 2-bromo-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | 2-bromo-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134640617 |
| Molecular Formula | C9H4BrF6NO |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 334.94 |
| IUPAC Name | 2-bromo-3,5-bis(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C9H4BrF6NO/c10-6-4(7(17)18)1-3(8(11,12)13)2-5(6)9(14,15)16/h1-2H,(H2,17,18) |
| InChIKey | ZPSUEJNTLOJUCC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |