C9H4F7NO — CID 118998212
3-fluoro-2,5-bis(trifluoromethyl)benzamide (PubChem CID 118998212) has the molecular formula C9H4F7NO and a molecular weight of 275.12 g/mol. Its IUPAC name is 3-fluoro-2,5-bis(trifluoromethyl)benzamide.
| Compound Name | 3-fluoro-2,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118998212 |
| Molecular Formula | C9H4F7NO |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 3-fluoro-2,5-bis(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1cc(C(F)(F)F)cc(F)c1C(F)(F)F |
| InChI | InChI=1S/C9H4F7NO/c10-5-2-3(8(11,12)13)1-4(7(17)18)6(5)9(14,15)16/h1-2H,(H2,17,18) |
| InChIKey | OPYFLCORXYXTSM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |