C9H4ClF6NO — CID 134624066
3-amino-2,5-bis(trifluoromethyl)benzoyl chloride (PubChem CID 134624066) has the molecular formula C9H4ClF6NO and a molecular weight of 291.58 g/mol. Its IUPAC name is 3-amino-2,5-bis(trifluoromethyl)benzoyl chloride.
| Compound Name | 3-amino-2,5-bis(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 134624066 |
| Molecular Formula | C9H4ClF6NO |
| Molecular Weight | 291.58 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-amino-2,5-bis(trifluoromethyl)benzoyl chloride |
| SMILES | Nc1cc(C(F)(F)F)cc(C(=O)Cl)c1C(F)(F)F |
| InChI | InChI=1S/C9H4ClF6NO/c10-7(18)4-1-3(8(11,12)13)2-5(17)6(4)9(14,15)16/h1-2H,17H2 |
| InChIKey | NKGKGDPQAXJFSG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|