C10H8BrF6N5 — CID 168601762
2-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168601762) has the molecular formula C10H8BrF6N5 and a molecular weight of 392.10 g/mol. Its IUPAC name is 2-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168601762 |
| Molecular Formula | C10H8BrF6N5 |
| Molecular Weight | 392.10 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cc(C(F)(F)F)cc(C(F)(F)F)c1Br |
| InChI | InChI=1S/C10H8BrF6N5/c11-6-4(10(15,16)17)1-3(9(12,13)14)2-5(6)21-8(20)22-7(18)19/h1-2H,(H6,18,19,20,21,22) |
| InChIKey | NGVRVNSUEHJUCL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.10 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|