About 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine
2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168605555) has the molecular formula C12H11F6N5O
and a molecular weight of 355.24 g/mol. Its IUPAC name is 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine.
Molecular Properties
| Compound Name | 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine |
| PubChem CID | 168605555 |
| Molecular Formula | C12H11F6N5O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | CC(=O)c1c(/N=C(\N)N=C(N)N)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F6N5O/c1-4(24)8-6(12(16,17)18)2-5(11(13,14)15)3-7(8)22-10(21)23-9(19)20/h2-3H,1H3,(H6,19,20,21,22,23) |
| InChIKey | ANLVPXUPFVQAED-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine?
The IUPAC name of 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine (CID 168605555) is 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine.
What is the SMILES notation for 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine?
The canonical SMILES for 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine is CC(=O)c1c(/N=C(\N)N=C(N)N)cc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine?
The InChIKey is ANLVPXUPFVQAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F6N5O/c1-4(24)8-6(12(16,17)18)2-5(11(13,14)15)3-7(8)22-10(21)23-9(19)20/h2-3H,1H3,(H6,19,20,21,22,23).
What are the key properties of 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine?
2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine has a molecular weight of 355.24 g/mol, XLogP of 2.15, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-acetyl-3,5-bis(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine is sourced from PubChem (CID 168605555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).