C12H11ClF3N7 — CID 168605207
2-[2-(4-chloropyrazol-1-yl)-5-(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168605207) has the molecular formula C12H11ClF3N7 and a molecular weight of 345.72 g/mol. Its IUPAC name is 2-[2-(4-chloropyrazol-1-yl)-5-(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[2-(4-chloropyrazol-1-yl)-5-(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168605207 |
| Molecular Formula | C12H11ClF3N7 |
| Molecular Weight | 345.72 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[2-(4-chloropyrazol-1-yl)-5-(trifluoromethyl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cc(C(F)(F)F)ccc1-n1cc(Cl)cn1 |
| InChI | InChI=1S/C12H11ClF3N7/c13-7-4-20-23(5-7)9-2-1-6(12(14,15)16)3-8(9)21-11(19)22-10(17)18/h1-5H,(H6,17,18,19,21,22) |
| InChIKey | YQRGAALPUOELPM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|