C14H12ClF3N6O — CID 168601907
2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168601907) has the molecular formula C14H12ClF3N6O and a molecular weight of 372.74 g/mol. Its IUPAC name is 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168601907 |
| Molecular Formula | C14H12ClF3N6O |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H12ClF3N6O/c15-8-5-7(14(16,17)18)6-22-11(8)25-10-4-2-1-3-9(10)23-13(21)24-12(19)20/h1-6H,(H6,19,20,21,23,24) |
| InChIKey | VLPJXLRGEHTVRW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|