C14H10Cl3F3N6O — CID 168603059
1-(diaminomethylidene)-2-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]guanidine (PubChem CID 168603059) has the molecular formula C14H10Cl3F3N6O and a molecular weight of 441.63 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]guanidine |
|---|---|
| PubChem CID | 168603059 |
| Molecular Formula | C14H10Cl3F3N6O |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3,5-dichloro-4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cc(Cl)c(Oc2ncc(C(F)(F)F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl3F3N6O/c15-7-2-6(25-13(23)26-12(21)22)3-8(16)10(7)27-11-9(17)1-5(4-24-11)14(18,19)20/h1-4H,(H6,21,22,23,25,26) |
| InChIKey | QYVZMEUVRXSBPI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|