C11H8Cl2F7N5 — CID 168601751
1-(diaminomethylidene)-2-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]guanidine (PubChem CID 168601751) has the molecular formula C11H8Cl2F7N5 and a molecular weight of 414.11 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 168601751 |
| Molecular Formula | C11H8Cl2F7N5 |
| Molecular Weight | 414.11 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N\c1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H8Cl2F7N5/c12-4-1-3(9(14,10(15,16)17)11(18,19)20)2-5(13)6(4)24-8(23)25-7(21)22/h1-2H,(H6,21,22,23,24,25) |
| InChIKey | DROVTRNCZLXRGO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.11 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|