C8H8ClFN6O2 — CID 168603454
2-(2-chloro-6-fluoro-4-nitrophenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168603454) has the molecular formula C8H8ClFN6O2 and a molecular weight of 274.64 g/mol. Its IUPAC name is 2-(2-chloro-6-fluoro-4-nitrophenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(2-chloro-6-fluoro-4-nitrophenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168603454 |
| Molecular Formula | C8H8ClFN6O2 |
| Molecular Weight | 274.64 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-(2-chloro-6-fluoro-4-nitrophenyl)-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N\c1c(F)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C8H8ClFN6O2/c9-4-1-3(16(17)18)2-5(10)6(4)14-8(13)15-7(11)12/h1-2H,(H6,11,12,13,14,15) |
| InChIKey | MRMBMHNMWWUKEW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.64 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|