C9H13N7O2 — CID 168601619
1-(diaminomethylidene)-2-[2-(methylamino)-5-nitrophenyl]guanidine (PubChem CID 168601619) has the molecular formula C9H13N7O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(methylamino)-5-nitrophenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(methylamino)-5-nitrophenyl]guanidine |
|---|---|
| PubChem CID | 168601619 |
| Molecular Formula | C9H13N7O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(methylamino)-5-nitrophenyl]guanidine |
| SMILES | CNc1ccc([N+](=O)[O-])cc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C9H13N7O2/c1-13-6-3-2-5(16(17)18)4-7(6)14-9(12)15-8(10)11/h2-4,13H,1H3,(H6,10,11,12,14,15) |
| InChIKey | KNWRXJBRRCFKGS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 157.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|