C10H3Cl3F7NO — CID 118065074
2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxybenzenecarboximidoyl chloride (PubChem CID 118065074) has the molecular formula C10H3Cl3F7NO and a molecular weight of 392.49 g/mol. Its IUPAC name is 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxybenzenecarboximidoyl chloride.
| Compound Name | 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxybenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 118065074 |
| Molecular Formula | C10H3Cl3F7NO |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxybenzenecarboximidoyl chloride |
| SMILES | ON=C(Cl)c1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H3Cl3F7NO/c11-4-1-3(2-5(12)6(4)7(13)21-22)8(14,9(15,16)17)10(18,19)20/h1-2,22H |
| InChIKey | JCPAZPMMGBOPHJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|