C15H6Cl4F6O2 — CID 174906043
2,6-dichloro-4-[1-(3,5-dichloro-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol (PubChem CID 174906043) has the molecular formula C15H6Cl4F6O2 and a molecular weight of 474.01 g/mol. Its IUPAC name is 2,6-dichloro-4-[1-(3,5-dichloro-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol.
| Compound Name | 2,6-dichloro-4-[1-(3,5-dichloro-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol |
|---|---|
| PubChem CID | 174906043 |
| Molecular Formula | C15H6Cl4F6O2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 471.90 |
| IUPAC Name | 2,6-dichloro-4-[1-(3,5-dichloro-4-hydroxyphenyl)-1,1,2,3,3,3-hexafluoropropan-2-yl]phenol |
| SMILES | Oc1c(Cl)cc(C(F)(F)C(F)(c2cc(Cl)c(O)c(Cl)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H6Cl4F6O2/c16-7-1-5(2-8(17)11(7)26)13(20,15(23,24)25)14(21,22)6-3-9(18)12(27)10(19)4-6/h1-4,26-27H |
| InChIKey | RLNQVTFOJMKWNC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |