C25H16Cl4O4 — CID 159764746
2,6-dichloro-4-[(3,5-dichloro-4-hydroxyphenyl)-bis(4-hydroxyphenyl)methyl]phenol (PubChem CID 159764746) has the molecular formula C25H16Cl4O4 and a molecular weight of 522.21 g/mol. Its IUPAC name is 2,6-dichloro-4-[(3,5-dichloro-4-hydroxyphenyl)-bis(4-hydroxyphenyl)methyl]phenol.
| Compound Name | 2,6-dichloro-4-[(3,5-dichloro-4-hydroxyphenyl)-bis(4-hydroxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 159764746 |
| Molecular Formula | C25H16Cl4O4 |
| Molecular Weight | 522.21 g/mol |
| Exact Mass | 519.98 |
| IUPAC Name | 2,6-dichloro-4-[(3,5-dichloro-4-hydroxyphenyl)-bis(4-hydroxyphenyl)methyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)(c2cc(Cl)c(O)c(Cl)c2)c2cc(Cl)c(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H16Cl4O4/c26-19-9-15(10-20(27)23(19)32)25(13-1-5-17(30)6-2-13,14-3-7-18(31)8-4-14)16-11-21(28)24(33)22(29)12-16/h1-12,30-33H |
| InChIKey | NFIUYEQXIKMXEM-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.21 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|