C20H16Cl2O2 — CID 21293255
4-[1-(3,4-dichlorophenyl)-1-(4-hydroxyphenyl)ethyl]phenol (PubChem CID 21293255) has the molecular formula C20H16Cl2O2 and a molecular weight of 359.25 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)-1-(4-hydroxyphenyl)ethyl]phenol.
| Compound Name | 4-[1-(3,4-dichlorophenyl)-1-(4-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 21293255 |
| Molecular Formula | C20H16Cl2O2 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)-1-(4-hydroxyphenyl)ethyl]phenol |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2O2/c1-20(13-2-7-16(23)8-3-13,14-4-9-17(24)10-5-14)15-6-11-18(21)19(22)12-15/h2-12,23-24H,1H3 |
| InChIKey | YFHBZYTWHRJUBY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|