C12H9Cl2NO2 — CID 622906
2,6-dichloro-4-(4-hydroxyanilino)phenol (PubChem CID 622906) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is 2,6-dichloro-4-(4-hydroxyanilino)phenol.
| Compound Name | 2,6-dichloro-4-(4-hydroxyanilino)phenol |
|---|---|
| PubChem CID | 622906 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 2,6-dichloro-4-(4-hydroxyanilino)phenol |
| SMILES | Oc1ccc(Nc2cc(Cl)c(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C12H9Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,15-17H |
| InChIKey | IFTGQCOAUCEONK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|