C18H10F14N2O2 — CID 87470352
2-amino-4-[1-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]-6-(trifluoromethyl)phenol (PubChem CID 87470352) has the molecular formula C18H10F14N2O2 and a molecular weight of 552.26 g/mol. Its IUPAC name is 2-amino-4-[1-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]-6-(trifluoromethyl)phenol.
| Compound Name | 2-amino-4-[1-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 87470352 |
| Molecular Formula | C18H10F14N2O2 |
| Molecular Weight | 552.26 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 2-amino-4-[1-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,2,3,3,3-hexafluoropropan-2-yl]-6-(trifluoromethyl)phenol |
| SMILES | Nc1cc(C(F)(C(F)(F)F)C(F)(F)c2cc(N)c(O)c(C(F)(F)C(F)(F)F)c2)cc(C(F)(F)F)c1O |
| InChI | InChI=1S/C18H10F14N2O2/c19-13(17(27,28)29,5-1-8(16(24,25)26)12(36)9(33)3-5)14(20,21)6-2-7(11(35)10(34)4-6)15(22,23)18(30,31)32/h1-4,35-36H,33-34H2 |
| InChIKey | LINVPZXPFXIWMN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.26 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|