C15H13ClF3N5O2 — CID 168592486
2-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]guanidine (PubChem CID 168592486) has the molecular formula C15H13ClF3N5O2 and a molecular weight of 387.75 g/mol. Its IUPAC name is 2-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]guanidine.
| Compound Name | 2-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592486 |
| Molecular Formula | C15H13ClF3N5O2 |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]guanidine |
| SMILES | COc1cccc(C=NN=C(N)N)c1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H13ClF3N5O2/c1-25-11-4-2-3-8(6-23-24-14(20)21)12(11)26-13-10(16)5-9(7-22-13)15(17,18)19/h2-7H,1H3,(H4,20,21,24) |
| InChIKey | HUZPRUHGFRDENX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|