C17H13ClF3N5O2S — CID 168627099
2-N-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627099) has the molecular formula C17H13ClF3N5O2S and a molecular weight of 443.84 g/mol. Its IUPAC name is 2-N-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627099 |
| Molecular Formula | C17H13ClF3N5O2S |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 2-N-[[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | COc1cccc(C=NNc2nc(N)cs2)c1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H13ClF3N5O2S/c1-27-12-4-2-3-9(6-24-26-16-25-13(22)8-29-16)14(12)28-15-11(18)5-10(7-23-15)17(19,20)21/h2-8H,22H2,1H3,(H,25,26) |
| InChIKey | HDJOPIBBOIRQIL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|