C17H12ClF3N4OS — CID 168619386
N-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168619386) has the molecular formula C17H12ClF3N4OS and a molecular weight of 412.82 g/mol. Its IUPAC name is N-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619386 |
| Molecular Formula | C17H12ClF3N4OS |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccc(Oc3ncc(C(F)(F)F)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C17H12ClF3N4OS/c1-10-9-27-16(24-10)25-23-7-11-2-4-13(5-3-11)26-15-14(18)6-12(8-22-15)17(19,20)21/h2-9H,1H3,(H,24,25) |
| InChIKey | RAJPBOZJJKKQJO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|