C13H14N4O — CID 168591904
2-[(8-methoxynaphthalen-1-yl)methylideneamino]guanidine (PubChem CID 168591904) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[(8-methoxynaphthalen-1-yl)methylideneamino]guanidine.
| Compound Name | 2-[(8-methoxynaphthalen-1-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591904 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[(8-methoxynaphthalen-1-yl)methylideneamino]guanidine |
| SMILES | COc1cccc2cccc(C=NN=C(N)N)c12 |
| InChI | InChI=1S/C13H14N4O/c1-18-11-7-3-5-9-4-2-6-10(12(9)11)8-16-17-13(14)15/h2-8H,1H3,(H4,14,15,17) |
| InChIKey | QICUBXMMHCKBBJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|