C9H11N3O3SZn — CID 172986565
zinc;N'-[(E)-(3-methoxy-2-oxidophenyl)methylideneamino]carbamimidothioate;hydrate (PubChem CID 172986565) has the molecular formula C9H11N3O3SZn and a molecular weight of 306.66 g/mol. Its IUPAC name is zinc;N'-[(E)-(3-methoxy-2-oxidophenyl)methylideneamino]carbamimidothioate;hydrate.
| Compound Name | zinc;N'-[(E)-(3-methoxy-2-oxidophenyl)methylideneamino]carbamimidothioate;hydrate |
|---|---|
| PubChem CID | 172986565 |
| Molecular Formula | C9H11N3O3SZn |
| Molecular Weight | 306.66 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | zinc;N'-[(E)-(3-methoxy-2-oxidophenyl)methylideneamino]carbamimidothioate;hydrate |
| SMILES | COc1cccc(/C=N/N=C(N)[S-])c1[O-].O.[Zn+2] |
| InChI | InChI=1S/C9H11N3O2S.H2O.Zn/c1-14-7-4-2-3-6(8(7)13)5-11-12-9(10)15;;/h2-5,13H,1H3,(H3,10,12,15);1H2;/q;;+2/p-2/b11-5+;; |
| InChIKey | CSWUTTRZXPHACM-JYENVBOSSA-L |
| XLogP | -0.86 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.66 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|