C26H32CuN2O4 — CID 139072232
copper bis(2-(cyclopentyliminomethyl)-6-methoxyphenolate) (PubChem CID 139072232) has the molecular formula C26H32CuN2O4 and a molecular weight of 500.10 g/mol. Its IUPAC name is copper bis(2-(cyclopentyliminomethyl)-6-methoxyphenolate).
| Compound Name | copper bis(2-(cyclopentyliminomethyl)-6-methoxyphenolate) |
|---|---|
| PubChem CID | 139072232 |
| Molecular Formula | C26H32CuN2O4 |
| Molecular Weight | 500.10 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | copper bis(2-(cyclopentyliminomethyl)-6-methoxyphenolate) |
| SMILES | COc1cccc(/C=N/C2CCCC2)c1[O-].COc1cccc(/C=N/C2CCCC2)c1[O-].[Cu+2] |
| InChI | InChI=1S/2C13H17NO2.Cu/c2*1-16-12-8-4-5-10(13(12)15)9-14-11-6-2-3-7-11;/h2*4-5,8-9,11,15H,2-3,6-7H2,1H3;/q;;+2/p-2/b2*14-9+; |
| InChIKey | HIHYQBSZVITTEV-ZNVPEIAMSA-L |
| XLogP | 4.26 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.10 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|