C28H36CoN2O4 — CID 139206912
cobalt(2+);bis(2-(cyclohexyliminomethyl)-6-methoxyphenolate) (PubChem CID 139206912) has the molecular formula C28H36CoN2O4 and a molecular weight of 523.54 g/mol. Its IUPAC name is cobalt(2+);bis(2-(cyclohexyliminomethyl)-6-methoxyphenolate).
| Compound Name | cobalt(2+);bis(2-(cyclohexyliminomethyl)-6-methoxyphenolate) |
|---|---|
| PubChem CID | 139206912 |
| Molecular Formula | C28H36CoN2O4 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | cobalt(2+);bis(2-(cyclohexyliminomethyl)-6-methoxyphenolate) |
| SMILES | COc1cccc(/C=N/C2CCCCC2)c1[O-].COc1cccc(/C=N/C2CCCCC2)c1[O-].[Co+2] |
| InChI | InChI=1S/2C14H19NO2.Co/c2*1-17-13-9-5-6-11(14(13)16)10-15-12-7-3-2-4-8-12;/h2*5-6,9-10,12,16H,2-4,7-8H2,1H3;/q;;+2/p-2/b2*15-10+; |
| InChIKey | UWBZSGXWIKRURU-ZQSWXEMLSA-L |
| XLogP | 5.04 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|