C11H15N3O2S — CID 110510355
methyl N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 110510355) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is methyl N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | methyl N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 110510355 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | methyl N'-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | COc1cccc(/C=N\N=C(/N)SC)c1OC |
| InChI | InChI=1S/C11H15N3O2S/c1-15-9-6-4-5-8(10(9)16-2)7-13-14-11(12)17-3/h4-7H,1-3H3,(H2,12,14)/b13-7- |
| InChIKey | UCQCHWWUZNJBCC-QPEQYQDCSA-N |
| XLogP | 1.72 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|