C14H16N4O2PdS — CID 5242184
N'-[(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;palladium(2+);2H-pyridin-1-ide (PubChem CID 5242184) has the molecular formula C14H16N4O2PdS and a molecular weight of 410.80 g/mol. Its IUPAC name is N'-[(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;palladium(2+);2H-pyridin-1-ide.
| Compound Name | N'-[(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;palladium(2+);2H-pyridin-1-ide |
|---|---|
| PubChem CID | 5242184 |
| Molecular Formula | C14H16N4O2PdS |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | N'-[(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;palladium(2+);2H-pyridin-1-ide |
| SMILES | C1=CC[N-]C=C1.COc1cccc(C=NN=C(N)[S-])c1O.[Pd+2] |
| InChI | InChI=1S/C9H11N3O2S.C5H6N.Pd/c1-14-7-4-2-3-6(8(7)13)5-11-12-9(10)15;1-2-4-6-5-3-1;/h2-5,13H,1H3,(H3,10,12,15);1-4H,5H2;/q;-1;+2/p-1 |
| InChIKey | WDHNHCSTKNMQPQ-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|