C20H24N6O4PdS2 — CID 135451827
bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-methylcarbamimidothioate);palladium(2+) (PubChem CID 135451827) has the molecular formula C20H24N6O4PdS2 and a molecular weight of 583.00 g/mol. Its IUPAC name is bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-methylcarbamimidothioate);palladium(2+).
| Compound Name | bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-methylcarbamimidothioate);palladium(2+) |
|---|---|
| PubChem CID | 135451827 |
| Molecular Formula | C20H24N6O4PdS2 |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | bis(N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-N'-methylcarbamimidothioate);palladium(2+) |
| SMILES | C/N=C(/[S-])N/N=C/c1cccc(OC)c1O.C/N=C(\[S-])N/N=C/c1cccc(OC)c1O.[Pd+2] |
| InChI | InChI=1S/2C10H13N3O2S.Pd/c2*1-11-10(16)13-12-6-7-4-3-5-8(15-2)9(7)14;/h2*3-6,14H,1-2H3,(H2,11,13,16);/q;;+2/p-2/b2*12-6+; |
| InChIKey | MOCVJEGWTBXJPQ-FWWOJAOHSA-L |
| XLogP | 1.71 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|